About 4-formamidohexan-2-yl formate
4-formamidohexan-2-yl formate (PubChem CID 20617665) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 4-formamidohexan-2-yl formate.
Molecular Properties
| Compound Name | 4-formamidohexan-2-yl formate |
| PubChem CID | 20617665 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 4-formamidohexan-2-yl formate |
| SMILES | CCC(CC(C)OC=O)NC=O |
| InChI | InChI=1S/C8H15NO3/c1-3-8(9-5-10)4-7(2)12-6-11/h5-8H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | RHVMAQBUBHNTKD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formamidohexan-2-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formamidohexan-2-yl formate?
The IUPAC name of 4-formamidohexan-2-yl formate (CID 20617665) is 4-formamidohexan-2-yl formate.
What is the SMILES notation for 4-formamidohexan-2-yl formate?
The canonical SMILES for 4-formamidohexan-2-yl formate is CCC(CC(C)OC=O)NC=O.
What is the InChIKey of 4-formamidohexan-2-yl formate?
The InChIKey is RHVMAQBUBHNTKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-3-8(9-5-10)4-7(2)12-6-11/h5-8H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 4-formamidohexan-2-yl formate?
4-formamidohexan-2-yl formate has a molecular weight of 173.21 g/mol, XLogP of 0.46, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formamidohexan-2-yl formate is sourced from PubChem (CID 20617665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).