About cyclopenta[b]pyridine-5,7-dione
cyclopenta[b]pyridine-5,7-dione (PubChem CID 20617921) has the molecular formula C8H5NO2
and a molecular weight of 147.13 g/mol. Its IUPAC name is cyclopenta[b]pyridine-5,7-dione.
Molecular Properties
| Compound Name | cyclopenta[b]pyridine-5,7-dione |
| PubChem CID | 20617921 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | cyclopenta[b]pyridine-5,7-dione |
| SMILES | O=C1CC(=O)c2ncccc21 |
| InChI | InChI=1S/C8H5NO2/c10-6-4-7(11)8-5(6)2-1-3-9-8/h1-3H,4H2 |
| InChIKey | UNPGUYKQLOVEHD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta[b]pyridine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[b]pyridine-5,7-dione?
The IUPAC name of cyclopenta[b]pyridine-5,7-dione (CID 20617921) is cyclopenta[b]pyridine-5,7-dione.
What is the SMILES notation for cyclopenta[b]pyridine-5,7-dione?
The canonical SMILES for cyclopenta[b]pyridine-5,7-dione is O=C1CC(=O)c2ncccc21.
What is the InChIKey of cyclopenta[b]pyridine-5,7-dione?
The InChIKey is UNPGUYKQLOVEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2/c10-6-4-7(11)8-5(6)2-1-3-9-8/h1-3H,4H2.
What are the key properties of cyclopenta[b]pyridine-5,7-dione?
cyclopenta[b]pyridine-5,7-dione has a molecular weight of 147.13 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[b]pyridine-5,7-dione is sourced from PubChem (CID 20617921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).