C14H21NO4S — CID 20617953
ethyl (2Z)-2-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)-4,4-dimethyl-3-oxopentanoate (PubChem CID 20617953) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is ethyl (2Z)-2-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)-4,4-dimethyl-3-oxopentanoate.
| Compound Name | ethyl (2Z)-2-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)-4,4-dimethyl-3-oxopentanoate |
|---|---|
| PubChem CID | 20617953 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | ethyl (2Z)-2-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)-4,4-dimethyl-3-oxopentanoate |
| SMILES | CCOC(=O)/C(C(=O)C(C)(C)C)=C1\SCC(=O)N1CC |
| InChI | InChI=1S/C14H21NO4S/c1-6-15-9(16)8-20-12(15)10(13(18)19-7-2)11(17)14(3,4)5/h6-8H2,1-5H3/b12-10- |
| InChIKey | LHLSCNBLOYZREE-BENRWUELSA-N |
| XLogP | 1.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|