C7H3F11 — CID 20618020
1,1,1,4,4,5,5,5-octafluoro-3-methyl-2-(trifluoromethyl)pent-2-ene (PubChem CID 20618020) has the molecular formula C7H3F11 and a molecular weight of 296.08 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-3-methyl-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-3-methyl-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 20618020 |
| Molecular Formula | C7H3F11 |
| Molecular Weight | 296.08 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-3-methyl-2-(trifluoromethyl)pent-2-ene |
| SMILES | CC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H3F11/c1-2(4(8,9)7(16,17)18)3(5(10,11)12)6(13,14)15/h1H3 |
| InChIKey | PJODYOBLCHCBJD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.08 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|