C15H16N4O4S2 — CID 20618451
1-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]piperidine-2,6-dicarboxylic acid (PubChem CID 20618451) has the molecular formula C15H16N4O4S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]piperidine-2,6-dicarboxylic acid.
| Compound Name | 1-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]piperidine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 20618451 |
| Molecular Formula | C15H16N4O4S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 1-[4-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]piperidine-2,6-dicarboxylic acid |
| SMILES | O=C(O)C1CCCC(C(=O)O)N1c1ccc(-n2c(=S)[nH][nH]c2=S)cc1 |
| InChI | InChI=1S/C15H16N4O4S2/c20-12(21)10-2-1-3-11(13(22)23)18(10)8-4-6-9(7-5-8)19-14(24)16-17-15(19)25/h4-7,10-11H,1-3H2,(H,16,24)(H,17,25)(H,20,21)(H,22,23) |
| InChIKey | YTGRSAOJTLLJPS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|