C21H21N5O5S2 — CID 20618543
2-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]iminomethoxy]-N-methylanilino]-3-hydroxy-4-oxopentanoic acid (PubChem CID 20618543) has the molecular formula C21H21N5O5S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]iminomethoxy]-N-methylanilino]-3-hydroxy-4-oxopentanoic acid.
| Compound Name | 2-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]iminomethoxy]-N-methylanilino]-3-hydroxy-4-oxopentanoic acid |
|---|---|
| PubChem CID | 20618543 |
| Molecular Formula | C21H21N5O5S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2-[3-[[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]phenyl]iminomethoxy]-N-methylanilino]-3-hydroxy-4-oxopentanoic acid |
| SMILES | CC(=O)C(O)C(C(=O)O)N(C)c1cccc(O/C=N/c2cccc(-n3c(=S)[nH][nH]c3=S)c2)c1 |
| InChI | InChI=1S/C21H21N5O5S2/c1-12(27)18(28)17(19(29)30)25(2)14-6-4-8-16(10-14)31-11-22-13-5-3-7-15(9-13)26-20(32)23-24-21(26)33/h3-11,17-18,28H,1-2H3,(H,23,32)(H,24,33)(H,29,30)/b22-11+ |
| InChIKey | AZRVYBNVDUPDTL-SSDVNMTOSA-N |
| XLogP | 3.17 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|