C16H14N4O2S2 — CID 20618547
2-[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]-2-phenylacetic acid (PubChem CID 20618547) has the molecular formula C16H14N4O2S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]-2-phenylacetic acid.
| Compound Name | 2-[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 20618547 |
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-[3-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]anilino]-2-phenylacetic acid |
| SMILES | O=C(O)C(Nc1cccc(-n2c(=S)[nH][nH]c2=S)c1)c1ccccc1 |
| InChI | InChI=1S/C16H14N4O2S2/c21-14(22)13(10-5-2-1-3-6-10)17-11-7-4-8-12(9-11)20-15(23)18-19-16(20)24/h1-9,13,17H,(H,18,23)(H,19,24)(H,21,22) |
| InChIKey | GHDCTNCPBOOLMM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|