C15H21N3O4S — CID 20618907
6-[bis(2-hydroxyethyl)carbamothioylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 20618907) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 6-[bis(2-hydroxyethyl)carbamothioylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | 6-[bis(2-hydroxyethyl)carbamothioylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 20618907 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 6-[bis(2-hydroxyethyl)carbamothioylamino]-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | O=C(O)C1CCc2cc(NC(=S)N(CCO)CCO)ccc2N1 |
| InChI | InChI=1S/C15H21N3O4S/c19-7-5-18(6-8-20)15(23)16-11-2-4-12-10(9-11)1-3-13(17-12)14(21)22/h2,4,9,13,17,19-20H,1,3,5-8H2,(H,16,23)(H,21,22) |
| InChIKey | BNUJPDCMCRVCPA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|