About benzyl(trimethyl)azanium iodide
benzyl(trimethyl)azanium iodide (PubChem CID 20619) has the molecular formula C10H16IN
and a molecular weight of 277.15 g/mol. Its IUPAC name is benzyl(trimethyl)azanium iodide.
Molecular Properties
| Compound Name | benzyl(trimethyl)azanium iodide |
| PubChem CID | 20619 |
| Molecular Formula | C10H16IN |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | benzyl(trimethyl)azanium iodide |
| SMILES | C[N+](C)(C)Cc1ccccc1.[I-] |
| InChI | InChI=1S/C10H16N.HI/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LRRJQNMXIDXNIM-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(trimethyl)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(trimethyl)azanium iodide?
The IUPAC name of benzyl(trimethyl)azanium iodide (CID 20619) is benzyl(trimethyl)azanium iodide.
What is the SMILES notation for benzyl(trimethyl)azanium iodide?
The canonical SMILES for benzyl(trimethyl)azanium iodide is C[N+](C)(C)Cc1ccccc1.[I-].
What is the InChIKey of benzyl(trimethyl)azanium iodide?
The InChIKey is LRRJQNMXIDXNIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16N.HI/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1.
What are the key properties of benzyl(trimethyl)azanium iodide?
benzyl(trimethyl)azanium iodide has a molecular weight of 277.15 g/mol, XLogP of -1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(trimethyl)azanium iodide is sourced from PubChem (CID 20619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).