C16H17N2NaO9S — CID 20619112
sodium (3-oxidoperoxysulfanyl-2,5-dioxopyrrolidin-1-yl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 20619112) has the molecular formula C16H17N2NaO9S and a molecular weight of 436.37 g/mol. Its IUPAC name is sodium (3-oxidoperoxysulfanyl-2,5-dioxopyrrolidin-1-yl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | sodium (3-oxidoperoxysulfanyl-2,5-dioxopyrrolidin-1-yl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20619112 |
| Molecular Formula | C16H17N2NaO9S |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | sodium (3-oxidoperoxysulfanyl-2,5-dioxopyrrolidin-1-yl) 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(ON1C(=O)CC(SOO[O-])C1=O)C1CCC(CN2C(=O)C=CC2=O)CC1.[Na+] |
| InChI | InChI=1S/C16H18N2O9S.Na/c19-12-5-6-13(20)17(12)8-9-1-3-10(4-2-9)16(23)25-18-14(21)7-11(15(18)22)28-27-26-24;/h5-6,9-11,24H,1-4,7-8H2;/q;+1/p-1 |
| InChIKey | CMQGFJSOMXIOIC-UHFFFAOYSA-M |
| XLogP | -3.82 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|