C10H11NV — CID 20619121
N-(2,4-dimethylbenzene-6-id-1-yl)ethanimine;vanadium(2+) (PubChem CID 20619121) has the molecular formula C10H11NV and a molecular weight of 196.15 g/mol. Its IUPAC name is N-(2,4-dimethylbenzene-6-id-1-yl)ethanimine;vanadium(2+).
| Compound Name | N-(2,4-dimethylbenzene-6-id-1-yl)ethanimine;vanadium(2+) |
|---|---|
| PubChem CID | 20619121 |
| Molecular Formula | C10H11NV |
| Molecular Weight | 196.15 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | N-(2,4-dimethylbenzene-6-id-1-yl)ethanimine;vanadium(2+) |
| SMILES | C/[C-]=N/c1[c-]cc(C)cc1C.[V+2] |
| InChI | InChI=1S/C10H11N.V/c1-4-11-10-6-5-8(2)7-9(10)3;/h5,7H,1-3H3;/q-2;+2 |
| InChIKey | ORYASNYOMMMIIF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|