About methyl 3-aminocyclopenta-1,3-diene-1-carboxylate
methyl 3-aminocyclopenta-1,3-diene-1-carboxylate (PubChem CID 20619345) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is methyl 3-aminocyclopenta-1,3-diene-1-carboxylate.
Analyze methyl 3-aminocyclopenta-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-aminocyclopenta-1,3-diene-1-carboxylate?
The IUPAC name of methyl 3-aminocyclopenta-1,3-diene-1-carboxylate (CID 20619345) is methyl 3-aminocyclopenta-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 3-aminocyclopenta-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 3-aminocyclopenta-1,3-diene-1-carboxylate is COC(=O)C1=CC(N)=CC1.
What is the InChIKey of methyl 3-aminocyclopenta-1,3-diene-1-carboxylate?
The InChIKey is IDUXQHPYJIXKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-10-7(9)5-2-3-6(8)4-5/h3-4H,2,8H2,1H3.
What are the key properties of methyl 3-aminocyclopenta-1,3-diene-1-carboxylate?
methyl 3-aminocyclopenta-1,3-diene-1-carboxylate has a molecular weight of 139.15 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-aminocyclopenta-1,3-diene-1-carboxylate is sourced from PubChem (CID 20619345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).