About 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid
4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid (PubChem CID 20619421) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid |
| PubChem CID | 20619421 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid |
| SMILES | CCNC(=O)Nc1cc(C)c(C(=O)O)c(C)c1 |
| InChI | InChI=1S/C12H16N2O3/c1-4-13-12(17)14-9-5-7(2)10(11(15)16)8(3)6-9/h5-6H,4H2,1-3H3,(H,15,16)(H2,13,14,17) |
| InChIKey | KVLJDJBCUVNERL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid?
The IUPAC name of 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid (CID 20619421) is 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid.
What is the SMILES notation for 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid?
The canonical SMILES for 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid is CCNC(=O)Nc1cc(C)c(C(=O)O)c(C)c1.
What is the InChIKey of 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid?
The InChIKey is KVLJDJBCUVNERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c1-4-13-12(17)14-9-5-7(2)10(11(15)16)8(3)6-9/h5-6H,4H2,1-3H3,(H,15,16)(H2,13,14,17).
What are the key properties of 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid?
4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid has a molecular weight of 236.27 g/mol, XLogP of 2.14, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylcarbamoylamino)-2,6-dimethylbenzoic acid is sourced from PubChem (CID 20619421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).