C28H31F3N4O8S — CID 20620248
1-cyclopropyl-4-[4-[3-[2,5-dioxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide (PubChem CID 20620248) has the molecular formula C28H31F3N4O8S and a molecular weight of 640.64 g/mol. Its IUPAC name is 1-cyclopropyl-4-[4-[3-[2,5-dioxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-4-[4-[3-[2,5-dioxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20620248 |
| Molecular Formula | C28H31F3N4O8S |
| Molecular Weight | 640.64 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | 1-cyclopropyl-4-[4-[3-[2,5-dioxo-3-[4-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
| SMILES | O=C1CN(c2ccc(OC(F)(F)F)cc2)C(=O)N1CCCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCN(C3CC3)CC2)cc1 |
| InChI | InChI=1S/C28H31F3N4O8S/c29-28(30,31)43-22-6-4-20(5-7-22)35-18-24(36)34(26(35)38)14-1-17-42-21-8-10-23(11-9-21)44(40,41)27(25(37)32-39)12-15-33(16-13-27)19-2-3-19/h4-11,19,39H,1-3,12-18H2,(H,32,37) |
| InChIKey | DDUAQZUBUBIAPF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|