C25H26F3N3O9S — CID 20620399
4-[4-[3-[2,5-dioxo-3-[3-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620399) has the molecular formula C25H26F3N3O9S and a molecular weight of 601.56 g/mol. Its IUPAC name is 4-[4-[3-[2,5-dioxo-3-[3-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-[2,5-dioxo-3-[3-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620399 |
| Molecular Formula | C25H26F3N3O9S |
| Molecular Weight | 601.56 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 4-[4-[3-[2,5-dioxo-3-[3-(trifluoromethoxy)phenyl]imidazolidin-1-yl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C1CN(c2cccc(OC(F)(F)F)c2)C(=O)N1CCCOc1ccc(S(=O)(=O)C2(C(=O)NO)CCOCC2)cc1 |
| InChI | InChI=1S/C25H26F3N3O9S/c26-25(27,28)40-19-4-1-3-17(15-19)31-16-21(32)30(23(31)34)11-2-12-39-18-5-7-20(8-6-18)41(36,37)24(22(33)29-35)9-13-38-14-10-24/h1,3-8,15,35H,2,9-14,16H2,(H,29,33) |
| InChIKey | JYPPVGXOCQTANW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|