About tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate
tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate (PubChem CID 20620877) has the molecular formula C21H33NO6S
and a molecular weight of 427.56 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate |
| PubChem CID | 20620877 |
| Molecular Formula | C21H33NO6S |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(CN)COc1ccc(S(=O)(=O)C2(C(=O)OC(C)(C)C)CCOCC2)cc1 |
| InChI | InChI=1S/C21H33NO6S/c1-19(2,3)28-18(23)21(10-12-26-13-11-21)29(24,25)17-8-6-16(7-9-17)27-15-20(4,5)14-22/h6-9H,10-15,22H2,1-5H3 |
| InChIKey | HVXSQFUJUUOHLH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate?
The IUPAC name of tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate (CID 20620877) is tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate?
The canonical SMILES for tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate is CC(C)(CN)COc1ccc(S(=O)(=O)C2(C(=O)OC(C)(C)C)CCOCC2)cc1.
What is the InChIKey of tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate?
The InChIKey is HVXSQFUJUUOHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33NO6S/c1-19(2,3)28-18(23)21(10-12-26-13-11-21)29(24,25)17-8-6-16(7-9-17)27-15-20(4,5)14-22/h6-9H,10-15,22H2,1-5H3.
What are the key properties of tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate?
tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate has a molecular weight of 427.56 g/mol, XLogP of 2.71, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-(3-amino-2,2-dimethylpropoxy)phenyl]sulfonyloxane-4-carboxylate is sourced from PubChem (CID 20620877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).