C12H19NO4 — CID 20621419
methyl 2-(3,3,6-trimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl)acetate (PubChem CID 20621419) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl 2-(3,3,6-trimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl)acetate.
| Compound Name | methyl 2-(3,3,6-trimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl)acetate |
|---|---|
| PubChem CID | 20621419 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methyl 2-(3,3,6-trimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl)acetate |
| SMILES | COC(=O)CC1C(C)C(=O)N2C1COC2(C)C |
| InChI | InChI=1S/C12H19NO4/c1-7-8(5-10(14)16-4)9-6-17-12(2,3)13(9)11(7)15/h7-9H,5-6H2,1-4H3 |
| InChIKey | UTVLGFQVJDJEMM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |