C27H25NO4 — CID 20621435
methyl 4-acetyl-1-benzhydryl-5-oxo-3-phenylpyrrolidine-2-carboxylate (PubChem CID 20621435) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl 4-acetyl-1-benzhydryl-5-oxo-3-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl 4-acetyl-1-benzhydryl-5-oxo-3-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 20621435 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | methyl 4-acetyl-1-benzhydryl-5-oxo-3-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)C(C(C)=O)C(=O)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO4/c1-18(29)22-23(19-12-6-3-7-13-19)25(27(31)32-2)28(26(22)30)24(20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22-25H,1-2H3 |
| InChIKey | DZXWOFQILUEXGA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|