C31H32F4N2O2 — CID 20621747
2-[4-(2,3-difluoro-4-pentylphenyl)-2,3-difluorophenyl]-5-[5-[(1E)-hexa-1,5-dienyl]-1,3-dioxan-2-yl]pyrimidine (PubChem CID 20621747) has the molecular formula C31H32F4N2O2 and a molecular weight of 540.60 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-pentylphenyl)-2,3-difluorophenyl]-5-[5-[(1E)-hexa-1,5-dienyl]-1,3-dioxan-2-yl]pyrimidine.
| Compound Name | 2-[4-(2,3-difluoro-4-pentylphenyl)-2,3-difluorophenyl]-5-[5-[(1E)-hexa-1,5-dienyl]-1,3-dioxan-2-yl]pyrimidine |
|---|---|
| PubChem CID | 20621747 |
| Molecular Formula | C31H32F4N2O2 |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-pentylphenyl)-2,3-difluorophenyl]-5-[5-[(1E)-hexa-1,5-dienyl]-1,3-dioxan-2-yl]pyrimidine |
| SMILES | C=CCC/C=C/C1COC(c2cnc(-c3ccc(-c4ccc(CCCCC)c(F)c4F)c(F)c3F)nc2)OC1 |
| InChI | InChI=1S/C31H32F4N2O2/c1-3-5-7-9-10-20-18-38-31(39-19-20)22-16-36-30(37-17-22)25-15-14-24(28(34)29(25)35)23-13-12-21(11-8-6-4-2)26(32)27(23)33/h3,9-10,12-17,20,31H,1,4-8,11,18-19H2,2H3/b10-9+ |
| InChIKey | ISYHCADKZYMQKP-MDZDMXLPSA-N |
| XLogP | 8.28 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|