C27H38F2OS2 — CID 20621760
2-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]-5-[(E)-prop-1-enyl]-1,3-dithiane (PubChem CID 20621760) has the molecular formula C27H38F2OS2 and a molecular weight of 480.73 g/mol. Its IUPAC name is 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]-5-[(E)-prop-1-enyl]-1,3-dithiane.
| Compound Name | 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]-5-[(E)-prop-1-enyl]-1,3-dithiane |
|---|---|
| PubChem CID | 20621760 |
| Molecular Formula | C27H38F2OS2 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]-5-[(E)-prop-1-enyl]-1,3-dithiane |
| SMILES | C/C=C/C1CSC(C2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)CC2)SC1 |
| InChI | InChI=1S/C27H38F2OS2/c1-3-5-18-16-31-27(32-17-18)22-12-8-20(9-13-22)19-6-10-21(11-7-19)23-14-15-24(30-4-2)26(29)25(23)28/h3,5,14-15,18-22,27H,4,6-13,16-17H2,1-2H3/b5-3+ |
| InChIKey | SFVCWQAVZOEAPA-HWKANZROSA-N |
| XLogP | 8.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|