C27H30F4O3S2 — CID 20621768
2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-5-[5-[(E)-pent-3-enyl]-1,3-dithian-2-yl]-1,3-dioxane (PubChem CID 20621768) has the molecular formula C27H30F4O3S2 and a molecular weight of 542.66 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-5-[5-[(E)-pent-3-enyl]-1,3-dithian-2-yl]-1,3-dioxane.
| Compound Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-5-[5-[(E)-pent-3-enyl]-1,3-dithian-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 20621768 |
| Molecular Formula | C27H30F4O3S2 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-5-[5-[(E)-pent-3-enyl]-1,3-dithian-2-yl]-1,3-dioxane |
| SMILES | C/C=C/CCC1CSC(C2COC(c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)OC2)SC1 |
| InChI | InChI=1S/C27H30F4O3S2/c1-3-5-6-7-16-14-35-27(36-15-16)17-12-33-26(34-13-17)20-9-8-18(22(28)24(20)30)19-10-11-21(32-4-2)25(31)23(19)29/h3,5,8-11,16-17,26-27H,4,6-7,12-15H2,1-2H3/b5-3+ |
| InChIKey | WCMBCYQYXGPQKG-HWKANZROSA-N |
| XLogP | 7.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|