C29H42F2O3 — CID 20621788
2-(4-butoxy-2,3-difluorophenyl)-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]-1,3-dioxane (PubChem CID 20621788) has the molecular formula C29H42F2O3 and a molecular weight of 476.65 g/mol. Its IUPAC name is 2-(4-butoxy-2,3-difluorophenyl)-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 2-(4-butoxy-2,3-difluorophenyl)-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20621788 |
| Molecular Formula | C29H42F2O3 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | 2-(4-butoxy-2,3-difluorophenyl)-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]-1,3-dioxane |
| SMILES | C/C=C/C1CCC(C2CCC(C3COC(c4ccc(OCCCC)c(F)c4F)OC3)CC2)CC1 |
| InChI | InChI=1S/C29H42F2O3/c1-3-5-17-32-26-16-15-25(27(30)28(26)31)29-33-18-24(19-34-29)23-13-11-22(12-14-23)21-9-7-20(6-4-2)8-10-21/h4,6,15-16,20-24,29H,3,5,7-14,17-19H2,1-2H3/b6-4+ |
| InChIKey | VUACFXINJCPBCJ-GQCTYLIASA-N |
| XLogP | 7.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|