C25H34F2O7 — CID 20621789
2-(4-butoxy-2,3-difluorophenyl)-5-[5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxan-2-yl]-1,3-dioxane (PubChem CID 20621789) has the molecular formula C25H34F2O7 and a molecular weight of 484.54 g/mol. Its IUPAC name is 2-(4-butoxy-2,3-difluorophenyl)-5-[5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxan-2-yl]-1,3-dioxane.
| Compound Name | 2-(4-butoxy-2,3-difluorophenyl)-5-[5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 20621789 |
| Molecular Formula | C25H34F2O7 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-(4-butoxy-2,3-difluorophenyl)-5-[5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxan-2-yl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(C2COC(C3COC(c4ccc(OCCCC)c(F)c4F)OC3)OC2)OC1 |
| InChI | InChI=1S/C25H34F2O7/c1-3-5-9-28-20-8-7-19(21(26)22(20)27)25-33-14-18(15-34-25)24-31-12-17(13-32-24)23-29-10-16(6-4-2)11-30-23/h4,6-8,16-18,23-25H,3,5,9-15H2,1-2H3/b6-4+ |
| InChIKey | MIJYSLICTDETOB-GQCTYLIASA-N |
| XLogP | 4.36 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|