C28H40F2OS2 — CID 20621814
2-but-3-enyl-5-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]-1,3-dithiane (PubChem CID 20621814) has the molecular formula C28H40F2OS2 and a molecular weight of 494.76 g/mol. Its IUPAC name is 2-but-3-enyl-5-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]-1,3-dithiane.
| Compound Name | 2-but-3-enyl-5-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]-1,3-dithiane |
|---|---|
| PubChem CID | 20621814 |
| Molecular Formula | C28H40F2OS2 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-but-3-enyl-5-[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl]-1,3-dithiane |
| SMILES | C=CCCC1SCC(C2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)CC2)CS1 |
| InChI | InChI=1S/C28H40F2OS2/c1-3-5-6-26-32-17-23(18-33-26)21-9-7-19(8-10-21)20-11-13-22(14-12-20)24-15-16-25(31-4-2)28(30)27(24)29/h3,15-16,19-23,26H,1,4-14,17-18H2,2H3 |
| InChIKey | ROEBYKODVLYMOX-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|