C28H38F2OS4 — CID 20621854
5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2-[2-[(1E)-hexa-1,5-dienyl]-1,3-dithian-5-yl]-1,3-dithiane (PubChem CID 20621854) has the molecular formula C28H38F2OS4 and a molecular weight of 556.88 g/mol. Its IUPAC name is 5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2-[2-[(1E)-hexa-1,5-dienyl]-1,3-dithian-5-yl]-1,3-dithiane.
| Compound Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2-[2-[(1E)-hexa-1,5-dienyl]-1,3-dithian-5-yl]-1,3-dithiane |
|---|---|
| PubChem CID | 20621854 |
| Molecular Formula | C28H38F2OS4 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-2-[2-[(1E)-hexa-1,5-dienyl]-1,3-dithian-5-yl]-1,3-dithiane |
| SMILES | C=CCC/C=C/C1SCC(C2SCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)CS2)CS1 |
| InChI | InChI=1S/C28H38F2OS4/c1-3-5-6-7-8-25-32-17-22(18-33-25)28-34-15-21(16-35-28)19-9-11-20(12-10-19)23-13-14-24(31-4-2)27(30)26(23)29/h3,7-8,13-14,19-22,25,28H,1,4-6,9-12,15-18H2,2H3/b8-7+ |
| InChIKey | XCZVGNKMNHGNMI-BQYQJAHWSA-N |
| XLogP | 9.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|