C26H36F2OS2 — CID 20621856
2-(4-ethenylcyclohexyl)-5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-1,3-dithiane (PubChem CID 20621856) has the molecular formula C26H36F2OS2 and a molecular weight of 466.70 g/mol. Its IUPAC name is 2-(4-ethenylcyclohexyl)-5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-1,3-dithiane.
| Compound Name | 2-(4-ethenylcyclohexyl)-5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-1,3-dithiane |
|---|---|
| PubChem CID | 20621856 |
| Molecular Formula | C26H36F2OS2 |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2-(4-ethenylcyclohexyl)-5-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-1,3-dithiane |
| SMILES | C=CC1CCC(C2SCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)CS2)CC1 |
| InChI | InChI=1S/C26H36F2OS2/c1-3-17-5-7-20(8-6-17)26-30-15-21(16-31-26)18-9-11-19(12-10-18)22-13-14-23(29-4-2)25(28)24(22)27/h3,13-14,17-21,26H,1,4-12,15-16H2,2H3 |
| InChIKey | UJYORFVLSJBUPU-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|