C20H18F4S2 — CID 20621859
2-ethenyl-5-[4-(4-ethyl-2,3-difluorophenyl)-2,3-difluorophenyl]-1,3-dithiane (PubChem CID 20621859) has the molecular formula C20H18F4S2 and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-ethenyl-5-[4-(4-ethyl-2,3-difluorophenyl)-2,3-difluorophenyl]-1,3-dithiane.
| Compound Name | 2-ethenyl-5-[4-(4-ethyl-2,3-difluorophenyl)-2,3-difluorophenyl]-1,3-dithiane |
|---|---|
| PubChem CID | 20621859 |
| Molecular Formula | C20H18F4S2 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-ethenyl-5-[4-(4-ethyl-2,3-difluorophenyl)-2,3-difluorophenyl]-1,3-dithiane |
| SMILES | C=CC1SCC(c2ccc(-c3ccc(CC)c(F)c3F)c(F)c2F)CS1 |
| InChI | InChI=1S/C20H18F4S2/c1-3-11-5-6-14(19(23)17(11)21)15-8-7-13(18(22)20(15)24)12-9-25-16(4-2)26-10-12/h4-8,12,16H,2-3,9-10H2,1H3 |
| InChIKey | GEHUGKGHIYLHKG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|