C24H32F2OS6 — CID 20621882
5-[(E)-but-1-enyl]-2-[2-[2-(4-ethoxy-2,3-difluorophenyl)-1,3-dithian-5-yl]-1,3-dithian-5-yl]-1,3-dithiane (PubChem CID 20621882) has the molecular formula C24H32F2OS6 and a molecular weight of 566.92 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-2-[2-[2-(4-ethoxy-2,3-difluorophenyl)-1,3-dithian-5-yl]-1,3-dithian-5-yl]-1,3-dithiane.
| Compound Name | 5-[(E)-but-1-enyl]-2-[2-[2-(4-ethoxy-2,3-difluorophenyl)-1,3-dithian-5-yl]-1,3-dithian-5-yl]-1,3-dithiane |
|---|---|
| PubChem CID | 20621882 |
| Molecular Formula | C24H32F2OS6 |
| Molecular Weight | 566.92 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | 5-[(E)-but-1-enyl]-2-[2-[2-(4-ethoxy-2,3-difluorophenyl)-1,3-dithian-5-yl]-1,3-dithian-5-yl]-1,3-dithiane |
| SMILES | CC/C=C/C1CSC(C2CSC(C3CSC(c4ccc(OCC)c(F)c4F)SC3)SC2)SC1 |
| InChI | InChI=1S/C24H32F2OS6/c1-3-5-6-15-9-28-22(29-10-15)16-11-30-23(31-12-16)17-13-32-24(33-14-17)18-7-8-19(27-4-2)21(26)20(18)25/h5-8,15-17,22-24H,3-4,9-14H2,1-2H3/b6-5+ |
| InChIKey | KVYQQYNULXRQSZ-AATRIKPKSA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.92 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|