C41H23F12N2O5P — CID 20621902
5-[2-[2-[3-[[3,5-bis(trifluoromethyl)phenyl]-(3-methylphenyl)phosphoryl]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 20621902) has the molecular formula C41H23F12N2O5P and a molecular weight of 882.59 g/mol. Its IUPAC name is 5-[2-[2-[3-[[3,5-bis(trifluoromethyl)phenyl]-(3-methylphenyl)phosphoryl]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2-[3-[[3,5-bis(trifluoromethyl)phenyl]-(3-methylphenyl)phosphoryl]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 20621902 |
| Molecular Formula | C41H23F12N2O5P |
| Molecular Weight | 882.59 g/mol |
| Exact Mass | 882.12 |
| IUPAC Name | 5-[2-[2-[3-[[3,5-bis(trifluoromethyl)phenyl]-(3-methylphenyl)phosphoryl]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1cccc(P(=O)(c2cccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(C)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C41H23F12N2O5P/c1-20-5-3-7-26(13-20)61(60,28-15-23(38(42,43)44)14-24(16-28)39(45,46)47)27-8-4-6-25(19-27)55-35(58)30-12-10-22(18-32(30)36(55)59)37(40(48,49)50,41(51,52)53)21-9-11-29-31(17-21)34(57)54(2)33(29)56/h3-19H,1-2H3 |
| InChIKey | VIGLGOMQPVEQIG-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.59 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|