C16H28O3 — CID 20622015
oxan-2-yl 1,4-dimethyl-2-propylcyclopentane-1-carboxylate (PubChem CID 20622015) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is oxan-2-yl 1,4-dimethyl-2-propylcyclopentane-1-carboxylate.
| Compound Name | oxan-2-yl 1,4-dimethyl-2-propylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 20622015 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | oxan-2-yl 1,4-dimethyl-2-propylcyclopentane-1-carboxylate |
| SMILES | CCCC1CC(C)CC1(C)C(=O)OC1CCCCO1 |
| InChI | InChI=1S/C16H28O3/c1-4-7-13-10-12(2)11-16(13,3)15(17)19-14-8-5-6-9-18-14/h12-14H,4-11H2,1-3H3 |
| InChIKey | WFEZOMWOHZYKSO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |