About [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate
[5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate (PubChem CID 20622156) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate |
| PubChem CID | 20622156 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CC(C)(COC)OC1=O |
| InChI | InChI=1S/C14H24O5/c1-7-12(2,3)10(15)19-14(5)8-13(4,9-17-6)18-11(14)16/h7-9H2,1-6H3 |
| InChIKey | AIXQJHCXDSEMMG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate?
The IUPAC name of [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate (CID 20622156) is [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate.
What is the SMILES notation for [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate?
The canonical SMILES for [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1(C)CC(C)(COC)OC1=O.
What is the InChIKey of [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate?
The InChIKey is AIXQJHCXDSEMMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O5/c1-7-12(2,3)10(15)19-14(5)8-13(4,9-17-6)18-11(14)16/h7-9H2,1-6H3.
What are the key properties of [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate?
[5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate has a molecular weight of 272.34 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methoxymethyl)-3,5-dimethyl-2-oxooxolan-3-yl] 2,2-dimethylbutanoate is sourced from PubChem (CID 20622156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).