About (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine
(NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine (PubChem CID 20622349) has the molecular formula C5H7N3OS
and a molecular weight of 157.20 g/mol. Its IUPAC name is (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine |
| PubChem CID | 20622349 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1csc(N)n1 |
| InChI | InChI=1S/C5H7N3OS/c1-3(8-9)4-2-10-5(6)7-4/h2,9H,1H3,(H2,6,7)/b8-3- |
| InChIKey | BUJNUJSCWOUYEV-BAQGIRSFSA-N |
| XLogP | 0.92 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine (CID 20622349) is (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine is C/C(=N/O)c1csc(N)n1.
What is the InChIKey of (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine?
The InChIKey is BUJNUJSCWOUYEV-BAQGIRSFSA-N. The full InChI is InChI=1S/C5H7N3OS/c1-3(8-9)4-2-10-5(6)7-4/h2,9H,1H3,(H2,6,7)/b8-3-.
What are the key properties of (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine?
(NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine has a molecular weight of 157.20 g/mol, XLogP of 0.92, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[1-(2-amino-1,3-thiazol-4-yl)ethylidene]hydroxylamine is sourced from PubChem (CID 20622349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).