About CID 20622388
CID 20622388 (PubChem CID 20622388) has the molecular formula C7H11BNO3
and a molecular weight of 167.98 g/mol.
Molecular Properties
| Compound Name | CID 20622388 |
| PubChem CID | 20622388 |
| Molecular Formula | C7H11BNO3 |
| Molecular Weight | 167.98 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | — |
| SMILES | C[B]C(CN=C=O)CC(=O)OC |
| InChI | InChI=1S/C7H11BNO3/c1-8-6(4-9-5-10)3-7(11)12-2/h6H,3-4H2,1-2H3 |
| InChIKey | CELWSUBVZINYAK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.98 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze CID 20622388 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20622388?
The IUPAC name of CID 20622388 (CID 20622388) is not available.
What is the SMILES notation for CID 20622388?
The canonical SMILES for CID 20622388 is C[B]C(CN=C=O)CC(=O)OC.
What is the InChIKey of CID 20622388?
The InChIKey is CELWSUBVZINYAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BNO3/c1-8-6(4-9-5-10)3-7(11)12-2/h6H,3-4H2,1-2H3.
What are the key properties of CID 20622388?
CID 20622388 has a molecular weight of 167.98 g/mol, XLogP of 0.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20622388 is sourced from PubChem (CID 20622388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).