C20H31N5O3 — CID 20622444
3-(2-methylpyrimidin-5-yl)-10-oxo-10-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)decanoic acid (PubChem CID 20622444) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-(2-methylpyrimidin-5-yl)-10-oxo-10-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)decanoic acid.
| Compound Name | 3-(2-methylpyrimidin-5-yl)-10-oxo-10-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)decanoic acid |
|---|---|
| PubChem CID | 20622444 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 3-(2-methylpyrimidin-5-yl)-10-oxo-10-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)decanoic acid |
| SMILES | Cc1ncc(C(CCCCCCC(=O)NC2=NCCCCN2)CC(=O)O)cn1 |
| InChI | InChI=1S/C20H31N5O3/c1-15-23-13-17(14-24-15)16(12-19(27)28)8-4-2-3-5-9-18(26)25-20-21-10-6-7-11-22-20/h13-14,16H,2-12H2,1H3,(H,27,28)(H2,21,22,25,26) |
| InChIKey | SGGFRUDZEQXGQR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|