C17H23N5O3 — CID 20622569
2-[1-(4-carbamimidoyl-2-methylphenyl)-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]acetic acid (PubChem CID 20622569) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[1-(4-carbamimidoyl-2-methylphenyl)-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]acetic acid.
| Compound Name | 2-[1-(4-carbamimidoyl-2-methylphenyl)-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]acetic acid |
|---|---|
| PubChem CID | 20622569 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-[1-(4-carbamimidoyl-2-methylphenyl)-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2C(=O)NCC23CCN(CC(=O)O)CC3)c(C)c1 |
| InChI | InChI=1S/C17H23N5O3/c1-11-8-12(15(18)19)2-3-13(11)22-16(25)20-10-17(22)4-6-21(7-5-17)9-14(23)24/h2-3,8H,4-7,9-10H2,1H3,(H3,18,19)(H,20,25)(H,23,24) |
| InChIKey | RSCQHQSTJDMQTC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|