C11H21N3O — CID 20622598
3-ethyl-3,8,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 20622598) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-ethyl-3,8,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 3-ethyl-3,8,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 20622598 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-ethyl-3,8,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CCN1CCC2(CCNC(=O)NC2)CC1 |
| InChI | InChI=1S/C11H21N3O/c1-2-14-7-4-11(5-8-14)3-6-12-10(15)13-9-11/h2-9H2,1H3,(H2,12,13,15) |
| InChIKey | HXTPVCVXFOGKHQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |