C13H24N2O3S2 — CID 20622996
tert-butyl N-[2-[2,2-dimethyl-4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]-2-oxoethyl]carbamate (PubChem CID 20622996) has the molecular formula C13H24N2O3S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is tert-butyl N-[2-[2,2-dimethyl-4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2,2-dimethyl-4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 20622996 |
| Molecular Formula | C13H24N2O3S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | tert-butyl N-[2-[2,2-dimethyl-4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1C(CS)CSC1(C)C |
| InChI | InChI=1S/C13H24N2O3S2/c1-12(2,3)18-11(17)14-6-10(16)15-9(7-19)8-20-13(15,4)5/h9,19H,6-8H2,1-5H3,(H,14,17) |
| InChIKey | QPGUKQZIJHWQNC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|