About N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate
N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 20623032) has the molecular formula C11H17N2O5S-
and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
Molecular Properties
| Compound Name | N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| PubChem CID | 20623032 |
| Molecular Formula | C11H17N2O5S- |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CC(C)(C)O/C([O-])=N/CC(=O)N1CCSC1C(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-11(2,3)18-10(17)12-6-7(14)13-4-5-19-8(13)9(15)16/h8H,4-6H2,1-3H3,(H,12,17)(H,15,16)/p-1 |
| InChIKey | XIXPBRLOPAOSTF-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate?
The IUPAC name of N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (CID 20623032) is N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
What is the SMILES notation for N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate?
The canonical SMILES for N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate is CC(C)(C)O/C([O-])=N/CC(=O)N1CCSC1C(=O)O.
What is the InChIKey of N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate?
The InChIKey is XIXPBRLOPAOSTF-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H18N2O5S/c1-11(2,3)18-10(17)12-6-7(14)13-4-5-19-8(13)9(15)16/h8H,4-6H2,1-3H3,(H,12,17)(H,15,16)/p-1.
What are the key properties of N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate?
N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate has a molecular weight of 289.33 g/mol, XLogP of -0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-carboxy-1,3-thiazolidin-3-yl)-2-oxoethyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate is sourced from PubChem (CID 20623032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).