About (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate
(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate (PubChem CID 2062320) has the molecular formula C13H17N3O6
and a molecular weight of 311.29 g/mol. Its IUPAC name is (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate.
Molecular Properties
| Compound Name | (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate |
| PubChem CID | 2062320 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate |
| SMILES | CC1(C)OCC(COC(=O)Nc2ccncc2)([N+](=O)[O-])CO1 |
| InChI | InChI=1S/C13H17N3O6/c1-12(2)21-8-13(9-22-12,16(18)19)7-20-11(17)15-10-3-5-14-6-4-10/h3-6H,7-9H2,1-2H3,(H,14,15,17) |
| InChIKey | BNFJMYLENQLROP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate?
The IUPAC name of (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate (CID 2062320) is (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate.
What is the SMILES notation for (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate?
The canonical SMILES for (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate is CC1(C)OCC(COC(=O)Nc2ccncc2)([N+](=O)[O-])CO1.
What is the InChIKey of (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate?
The InChIKey is BNFJMYLENQLROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O6/c1-12(2)21-8-13(9-22-12,16(18)19)7-20-11(17)15-10-3-5-14-6-4-10/h3-6H,7-9H2,1-2H3,(H,14,15,17).
What are the key properties of (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate?
(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate has a molecular weight of 311.29 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl N-pyridin-4-ylcarbamate is sourced from PubChem (CID 2062320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).