About 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde
3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde (PubChem CID 20623627) has the molecular formula C6H7NOS3
and a molecular weight of 205.33 g/mol. Its IUPAC name is 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde |
| PubChem CID | 20623627 |
| Molecular Formula | C6H7NOS3 |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde |
| SMILES | CSc1nsc(SC)c1C=O |
| InChI | InChI=1S/C6H7NOS3/c1-9-5-4(3-8)6(10-2)11-7-5/h3H,1-2H3 |
| InChIKey | QJDDKHWSQNACAL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde?
The IUPAC name of 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde (CID 20623627) is 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde.
What is the SMILES notation for 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde?
The canonical SMILES for 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde is CSc1nsc(SC)c1C=O.
What is the InChIKey of 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde?
The InChIKey is QJDDKHWSQNACAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NOS3/c1-9-5-4(3-8)6(10-2)11-7-5/h3H,1-2H3.
What are the key properties of 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde?
3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde has a molecular weight of 205.33 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carbaldehyde is sourced from PubChem (CID 20623627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).