C6H11NO2S — CID 20623633
1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-ylmethanethiol (PubChem CID 20623633) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is 1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-ylmethanethiol.
| Compound Name | 1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-ylmethanethiol |
|---|---|
| PubChem CID | 20623633 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-ylmethanethiol |
| SMILES | SCC12COCN1COC2 |
| InChI | InChI=1S/C6H11NO2S/c10-3-6-1-8-4-7(6)5-9-2-6/h10H,1-5H2 |
| InChIKey | AUEICPFQXYOYAD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|