About 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one
5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one (PubChem CID 20623687) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one.
Molecular Properties
| Compound Name | 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one |
| PubChem CID | 20623687 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one |
| SMILES | O=C1C=C(CCO)OC2C=COC12 |
| InChI | InChI=1S/C9H10O4/c10-3-1-6-5-7(11)9-8(13-6)2-4-12-9/h2,4-5,8-10H,1,3H2 |
| InChIKey | KNVFETRDYBDSNR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one?
The IUPAC name of 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one (CID 20623687) is 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one.
What is the SMILES notation for 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one?
The canonical SMILES for 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one is O=C1C=C(CCO)OC2C=COC12.
What is the InChIKey of 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one?
The InChIKey is KNVFETRDYBDSNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c10-3-1-6-5-7(11)9-8(13-6)2-4-12-9/h2,4-5,8-10H,1,3H2.
What are the key properties of 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one?
5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one has a molecular weight of 182.17 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethyl)-3a,7a-dihydrofuro[3,2-b]pyran-7-one is sourced from PubChem (CID 20623687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).