About 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione
2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione (PubChem CID 2062370) has the molecular formula C15H11F2N3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione |
| PubChem CID | 2062370 |
| Molecular Formula | C15H11F2N3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione |
| SMILES | FC(F)n1nc(-c2ccccc2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C15H11F2N3S/c16-14(17)20-15(21)19(12-9-5-2-6-10-12)13(18-20)11-7-3-1-4-8-11/h1-10,14H |
| InChIKey | GVFPRQSJAMUMMN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione?
The IUPAC name of 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione (CID 2062370) is 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione.
What is the SMILES notation for 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione?
The canonical SMILES for 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione is FC(F)n1nc(-c2ccccc2)n(-c2ccccc2)c1=S.
What is the InChIKey of 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione?
The InChIKey is GVFPRQSJAMUMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2N3S/c16-14(17)20-15(21)19(12-9-5-2-6-10-12)13(18-20)11-7-3-1-4-8-11/h1-10,14H.
What are the key properties of 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione?
2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione has a molecular weight of 303.34 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-4,5-diphenyl-1,2,4-triazole-3-thione is sourced from PubChem (CID 2062370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).