About 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid
4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid (PubChem CID 20623749) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid |
| PubChem CID | 20623749 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid |
| SMILES | CCOC1=C(C(=O)O)CNC1=O |
| InChI | InChI=1S/C7H9NO4/c1-2-12-5-4(7(10)11)3-8-6(5)9/h2-3H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | XJHZHWPJDRNCOS-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid?
The IUPAC name of 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid (CID 20623749) is 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid.
What is the SMILES notation for 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid?
The canonical SMILES for 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid is CCOC1=C(C(=O)O)CNC1=O.
What is the InChIKey of 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid?
The InChIKey is XJHZHWPJDRNCOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-2-12-5-4(7(10)11)3-8-6(5)9/h2-3H2,1H3,(H,8,9)(H,10,11).
What are the key properties of 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid?
4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid has a molecular weight of 171.15 g/mol, XLogP of -0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-5-oxo-1,2-dihydropyrrole-3-carboxylic acid is sourced from PubChem (CID 20623749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).