About 4-oxo-2,3-dihydropyran-5-carbaldehyde
4-oxo-2,3-dihydropyran-5-carbaldehyde (PubChem CID 20623870) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is 4-oxo-2,3-dihydropyran-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-oxo-2,3-dihydropyran-5-carbaldehyde |
| PubChem CID | 20623870 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 4-oxo-2,3-dihydropyran-5-carbaldehyde |
| SMILES | O=CC1=COCCC1=O |
| InChI | InChI=1S/C6H6O3/c7-3-5-4-9-2-1-6(5)8/h3-4H,1-2H2 |
| InChIKey | HCEROBBJNONWAN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-2,3-dihydropyran-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2,3-dihydropyran-5-carbaldehyde?
The IUPAC name of 4-oxo-2,3-dihydropyran-5-carbaldehyde (CID 20623870) is 4-oxo-2,3-dihydropyran-5-carbaldehyde.
What is the SMILES notation for 4-oxo-2,3-dihydropyran-5-carbaldehyde?
The canonical SMILES for 4-oxo-2,3-dihydropyran-5-carbaldehyde is O=CC1=COCCC1=O.
What is the InChIKey of 4-oxo-2,3-dihydropyran-5-carbaldehyde?
The InChIKey is HCEROBBJNONWAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c7-3-5-4-9-2-1-6(5)8/h3-4H,1-2H2.
What are the key properties of 4-oxo-2,3-dihydropyran-5-carbaldehyde?
4-oxo-2,3-dihydropyran-5-carbaldehyde has a molecular weight of 126.11 g/mol, XLogP of 0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydropyran-5-carbaldehyde is sourced from PubChem (CID 20623870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).