About (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol
(5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol (PubChem CID 20623930) has the molecular formula C10H10ClN3O3S
and a molecular weight of 287.73 g/mol. Its IUPAC name is (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol.
Molecular Properties
| Compound Name | (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol |
| PubChem CID | 20623930 |
| Molecular Formula | C10H10ClN3O3S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol |
| SMILES | Cc1nn(C)c(Cl)c1C(O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H10ClN3O3S/c1-5-8(10(11)13(2)12-5)9(15)6-3-4-7(18-6)14(16)17/h3-4,9,15H,1-2H3 |
| InChIKey | IJQYFULBQKUMIU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol?
The IUPAC name of (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol (CID 20623930) is (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol.
What is the SMILES notation for (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol?
The canonical SMILES for (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol is Cc1nn(C)c(Cl)c1C(O)c1ccc([N+](=O)[O-])s1.
What is the InChIKey of (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol?
The InChIKey is IJQYFULBQKUMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O3S/c1-5-8(10(11)13(2)12-5)9(15)6-3-4-7(18-6)14(16)17/h3-4,9,15H,1-2H3.
What are the key properties of (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol?
(5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol has a molecular weight of 287.73 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1,3-dimethylpyrazol-4-yl)-(5-nitrothiophen-2-yl)methanol is sourced from PubChem (CID 20623930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).