About 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde
5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde (PubChem CID 20623940) has the molecular formula C5H6N2O2S
and a molecular weight of 158.18 g/mol. Its IUPAC name is 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde |
| PubChem CID | 20623940 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde |
| SMILES | CCOc1nc(C=O)ns1 |
| InChI | InChI=1S/C5H6N2O2S/c1-2-9-5-6-4(3-8)7-10-5/h3H,2H2,1H3 |
| InChIKey | FYYNIRKLXMLJOF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde?
The IUPAC name of 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde (CID 20623940) is 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde.
What is the SMILES notation for 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde?
The canonical SMILES for 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde is CCOc1nc(C=O)ns1.
What is the InChIKey of 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde?
The InChIKey is FYYNIRKLXMLJOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S/c1-2-9-5-6-4(3-8)7-10-5/h3H,2H2,1H3.
What are the key properties of 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde?
5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde has a molecular weight of 158.18 g/mol, XLogP of 0.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-1,2,4-thiadiazole-3-carbaldehyde is sourced from PubChem (CID 20623940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).