C13H22N2O3S2 — CID 20624410
tert-butyl N-[2-(4-formyl-2,2-dimethyl-1,3-thiazolidin-3-yl)-2-sulfanylideneethyl]carbamate (PubChem CID 20624410) has the molecular formula C13H22N2O3S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is tert-butyl N-[2-(4-formyl-2,2-dimethyl-1,3-thiazolidin-3-yl)-2-sulfanylideneethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-formyl-2,2-dimethyl-1,3-thiazolidin-3-yl)-2-sulfanylideneethyl]carbamate |
|---|---|
| PubChem CID | 20624410 |
| Molecular Formula | C13H22N2O3S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | tert-butyl N-[2-(4-formyl-2,2-dimethyl-1,3-thiazolidin-3-yl)-2-sulfanylideneethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=S)N1C(C=O)CSC1(C)C |
| InChI | InChI=1S/C13H22N2O3S2/c1-12(2,3)18-11(17)14-6-10(19)15-9(7-16)8-20-13(15,4)5/h7,9H,6,8H2,1-5H3,(H,14,17) |
| InChIKey | KZZDUZMREHJNLH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|