About 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole
2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole (PubChem CID 20624493) has the molecular formula C17H14N2O3S
and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole |
| PubChem CID | 20624493 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole |
| SMILES | c1ccc(COCc2csc(-c3ccc4c(c3)OCO4)n2)nc1 |
| InChI | InChI=1S/C17H14N2O3S/c1-2-6-18-13(3-1)8-20-9-14-10-23-17(19-14)12-4-5-15-16(7-12)22-11-21-15/h1-7,10H,8-9,11H2 |
| InChIKey | VLUCAXYGTDCBNP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole (CID 20624493) is 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole is c1ccc(COCc2csc(-c3ccc4c(c3)OCO4)n2)nc1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole?
The InChIKey is VLUCAXYGTDCBNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3S/c1-2-6-18-13(3-1)8-20-9-14-10-23-17(19-14)12-4-5-15-16(7-12)22-11-21-15/h1-7,10H,8-9,11H2.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole?
2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole has a molecular weight of 326.38 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-4-(pyridin-2-ylmethoxymethyl)-1,3-thiazole is sourced from PubChem (CID 20624493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).