C20H32N4O3Si — CID 20624737
[(3aS,4S,6R,6aR)-2,2-dimethyl-4-(5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 20624737) has the molecular formula C20H32N4O3Si and a molecular weight of 404.59 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-2,2-dimethyl-4-(5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4S,6R,6aR)-2,2-dimethyl-4-(5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 20624737 |
| Molecular Formula | C20H32N4O3Si |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [(3aS,4S,6R,6aR)-2,2-dimethyl-4-(5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)N[C@H]2c1c[nH]c2cncnc12 |
| InChI | InChI=1S/C20H32N4O3Si/c1-19(2,3)28(6,7)25-10-14-17-18(27-20(4,5)26-17)16(24-14)12-8-22-13-9-21-11-23-15(12)13/h8-9,11,14,16-18,22,24H,10H2,1-7H3/t14-,16+,17-,18+/m1/s1 |
| InChIKey | BATXPHRGWMHHKU-SPUZQDLCSA-N |
| XLogP | 3.51 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|